C20H16Cl2O6S2 — CID 2799565
bis(4-chloro-3-methylphenyl) benzene-1,3-disulfonate (PubChem CID 2799565) has the molecular formula C20H16Cl2O6S2 and a molecular weight of 487.38 g/mol. Its IUPAC name is bis(4-chloro-3-methylphenyl) benzene-1,3-disulfonate.
| Compound Name | bis(4-chloro-3-methylphenyl) benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 2799565 |
| Molecular Formula | C20H16Cl2O6S2 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | bis(4-chloro-3-methylphenyl) benzene-1,3-disulfonate |
| SMILES | Cc1cc(OS(=O)(=O)c2cccc(S(=O)(=O)Oc3ccc(Cl)c(C)c3)c2)ccc1Cl |
| InChI | InChI=1S/C20H16Cl2O6S2/c1-13-10-15(6-8-19(13)21)27-29(23,24)17-4-3-5-18(12-17)30(25,26)28-16-7-9-20(22)14(2)11-16/h3-12H,1-2H3 |
| InChIKey | MPYIYHVWLNQWJR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|