C13H9ClF2O3S — CID 30325627
(4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate (PubChem CID 30325627) has the molecular formula C13H9ClF2O3S and a molecular weight of 318.73 g/mol. Its IUPAC name is (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate.
| Compound Name | (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 30325627 |
| Molecular Formula | C13H9ClF2O3S |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)c2c(F)cccc2F)ccc1Cl |
| InChI | InChI=1S/C13H9ClF2O3S/c1-8-7-9(5-6-10(8)14)19-20(17,18)13-11(15)3-2-4-12(13)16/h2-7H,1H3 |
| InChIKey | BKMPPGMAYLZYPJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|