(4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate

C13H9ClF2O3S — CID 30325627

IUPAC(4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate
SMILESCc1cc(OS(=O)(=O)c2c(F)cccc2F)ccc1Cl
InChIInChI=1S/C13H9ClF2O3S/c1-8-7-9(5-6-10(8)14)19-20(17,18)13-11(15)3-2-4-12(13)16/h2-7H,1H3
InChIKeyBKMPPGMAYLZYPJ-UHFFFAOYSA-N
MW318.73 g/mol
LogP3.69
Rot. Bonds3

About (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate

(4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate (PubChem CID 30325627) has the molecular formula C13H9ClF2O3S and a molecular weight of 318.73 g/mol. Its IUPAC name is (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate.

Molecular Properties

Compound Name(4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate
PubChem CID30325627
Molecular FormulaC13H9ClF2O3S
Molecular Weight318.73 g/mol
Exact Mass317.99
IUPAC Name(4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate
SMILESCc1cc(OS(=O)(=O)c2c(F)cccc2F)ccc1Cl
InChIInChI=1S/C13H9ClF2O3S/c1-8-7-9(5-6-10(8)14)19-20(17,18)13-11(15)3-2-4-12(13)16/h2-7H,1H3
InChIKeyBKMPPGMAYLZYPJ-UHFFFAOYSA-N
XLogP3.69
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.73
LogP ≤ 53.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate?
The IUPAC name of (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate (CID 30325627) is (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate.
What is the SMILES notation for (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate?
The canonical SMILES for (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate is Cc1cc(OS(=O)(=O)c2c(F)cccc2F)ccc1Cl.
What is the InChIKey of (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate?
The InChIKey is BKMPPGMAYLZYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClF2O3S/c1-8-7-9(5-6-10(8)14)19-20(17,18)13-11(15)3-2-4-12(13)16/h2-7H,1H3.
What are the key properties of (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate?
(4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate has a molecular weight of 318.73 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3-methylphenyl) 2,6-difluorobenzenesulfonate is sourced from PubChem (CID 30325627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).