C15H21NO3 — CID 2801417
amino 2-methyl-2-[(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propanoate (PubChem CID 2801417) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is amino 2-methyl-2-[(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propanoate.
| Compound Name | amino 2-methyl-2-[(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propanoate |
|---|---|
| PubChem CID | 2801417 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | amino 2-methyl-2-[(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propanoate |
| SMILES | Cc1ccc(OC(C)(C)C(=O)ON)c2c1CCCC2 |
| InChI | InChI=1S/C15H21NO3/c1-10-8-9-13(12-7-5-4-6-11(10)12)18-15(2,3)14(17)19-16/h8-9H,4-7,16H2,1-3H3 |
| InChIKey | MTEJONHJQZAHMR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|