methyl 2-naphthalen-2-yloxyacetate

C13H12O3 — CID 612186

IUPACmethyl 2-naphthalen-2-yloxyacetate
SMILESCOC(=O)COc1ccc2ccccc2c1
InChIInChI=1S/C13H12O3/c1-15-13(14)9-16-12-7-6-10-4-2-3-5-11(10)8-12/h2-8H,9H2,1H3
InChIKeyAMURPBCUFDCTEW-UHFFFAOYSA-N
MW216.24 g/mol
LogP2.39
Rot. Bonds3

About methyl 2-naphthalen-2-yloxyacetate

methyl 2-naphthalen-2-yloxyacetate (PubChem CID 612186) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl 2-naphthalen-2-yloxyacetate.

Molecular Properties

Compound Namemethyl 2-naphthalen-2-yloxyacetate
PubChem CID612186
Molecular FormulaC13H12O3
Molecular Weight216.24 g/mol
Exact Mass216.08
IUPAC Namemethyl 2-naphthalen-2-yloxyacetate
SMILESCOC(=O)COc1ccc2ccccc2c1
InChIInChI=1S/C13H12O3/c1-15-13(14)9-16-12-7-6-10-4-2-3-5-11(10)8-12/h2-8H,9H2,1H3
InChIKeyAMURPBCUFDCTEW-UHFFFAOYSA-N
XLogP2.39
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 52.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-naphthalen-2-yloxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-naphthalen-2-yloxyacetate?
The IUPAC name of methyl 2-naphthalen-2-yloxyacetate (CID 612186) is methyl 2-naphthalen-2-yloxyacetate.
What is the SMILES notation for methyl 2-naphthalen-2-yloxyacetate?
The canonical SMILES for methyl 2-naphthalen-2-yloxyacetate is COC(=O)COc1ccc2ccccc2c1.
What is the InChIKey of methyl 2-naphthalen-2-yloxyacetate?
The InChIKey is AMURPBCUFDCTEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c1-15-13(14)9-16-12-7-6-10-4-2-3-5-11(10)8-12/h2-8H,9H2,1H3.
What are the key properties of methyl 2-naphthalen-2-yloxyacetate?
methyl 2-naphthalen-2-yloxyacetate has a molecular weight of 216.24 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-naphthalen-2-yloxyacetate is sourced from PubChem (CID 612186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).