C16H12Cl2O2S — CID 2801839
3-(2,5-dichlorophenyl)sulfanyl-1-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 2801839) has the molecular formula C16H12Cl2O2S and a molecular weight of 339.24 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)sulfanyl-1-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,5-dichlorophenyl)sulfanyl-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2801839 |
| Molecular Formula | C16H12Cl2O2S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 3-(2,5-dichlorophenyl)sulfanyl-1-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=CSc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2O2S/c1-20-13-5-2-11(3-6-13)15(19)8-9-21-16-10-12(17)4-7-14(16)18/h2-10H,1H3 |
| InChIKey | BCCHKSOMNHCNSK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|