C16H22N2O3S — CID 2802758
2-(benzenesulfonyl)-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)acetamide (PubChem CID 2802758) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)acetamide |
|---|---|
| PubChem CID | 2802758 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(benzenesulfonyl)-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)acetamide |
| SMILES | CN1C2CCC1CC(NC(=O)CS(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C16H22N2O3S/c1-18-13-7-8-14(18)10-12(9-13)17-16(19)11-22(20,21)15-5-3-2-4-6-15/h2-6,12-14H,7-11H2,1H3,(H,17,19) |
| InChIKey | YFWQISPPCPCIPW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |