C25H22Cl4N2O2 — CID 2803457
2,3,4,5-tetrachloro-6-(2,3,4,5,6-pentamethylbenzoyl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 2803457) has the molecular formula C25H22Cl4N2O2 and a molecular weight of 524.28 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-(2,3,4,5,6-pentamethylbenzoyl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2,3,4,5-tetrachloro-6-(2,3,4,5,6-pentamethylbenzoyl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2803457 |
| Molecular Formula | C25H22Cl4N2O2 |
| Molecular Weight | 524.28 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-(2,3,4,5,6-pentamethylbenzoyl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1c(C)c(C)c(C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)NCc2cccnc2)c(C)c1C |
| InChI | InChI=1S/C25H22Cl4N2O2/c1-11-12(2)14(4)17(15(5)13(11)3)24(32)18-19(21(27)23(29)22(28)20(18)26)25(33)31-10-16-7-6-8-30-9-16/h6-9H,10H2,1-5H3,(H,31,33) |
| InChIKey | UAVDARKMWZVRQG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.28 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|