C10H6Cl2N4S — CID 2803666
2-[4-(3,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]acetonitrile (PubChem CID 2803666) has the molecular formula C10H6Cl2N4S and a molecular weight of 285.16 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]acetonitrile.
| Compound Name | 2-[4-(3,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]acetonitrile |
|---|---|
| PubChem CID | 2803666 |
| Molecular Formula | C10H6Cl2N4S |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]acetonitrile |
| SMILES | N#CCc1n[nH]c(=S)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H6Cl2N4S/c11-7-2-1-6(5-8(7)12)16-9(3-4-13)14-15-10(16)17/h1-2,5H,3H2,(H,15,17) |
| InChIKey | YWLJWSBPAVYSOB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|