C16H21N3OS — CID 2803750
1-[(2S)-2-bicyclo[2.2.1]heptanyl]-3-[(4-methoxyphenyl)methylideneamino]thiourea (PubChem CID 2803750) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-[(2S)-2-bicyclo[2.2.1]heptanyl]-3-[(4-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(2S)-2-bicyclo[2.2.1]heptanyl]-3-[(4-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2803750 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[(2S)-2-bicyclo[2.2.1]heptanyl]-3-[(4-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(C=NNC(=S)N[C@H]2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C16H21N3OS/c1-20-14-6-3-11(4-7-14)10-17-19-16(21)18-15-9-12-2-5-13(15)8-12/h3-4,6-7,10,12-13,15H,2,5,8-9H2,1H3,(H2,18,19,21)/t12?,13?,15-/m0/s1 |
| InChIKey | ZGSFPEWTKYAMHW-PIMMBPRGSA-N |
| XLogP | 2.68 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|