C21H10F4N4O5S — CID 2803998
2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one (PubChem CID 2803998) has the molecular formula C21H10F4N4O5S and a molecular weight of 506.39 g/mol. Its IUPAC name is 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2803998 |
| Molecular Formula | C21H10F4N4O5S |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-3-(4-fluorophenyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(Sc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H10F4N4O5S/c22-12-5-7-13(8-6-12)27-19(30)14-3-1-2-4-15(14)26-20(27)35-18-16(28(31)32)9-11(21(23,24)25)10-17(18)29(33)34/h1-10H |
| InChIKey | NDJOBTNVIBFTCC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 121.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|