C22H17N3O5S — CID 2525740
3-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)sulfanylquinazolin-4-one (PubChem CID 2525740) has the molecular formula C22H17N3O5S and a molecular weight of 435.46 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)sulfanylquinazolin-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2525740 |
| Molecular Formula | C22H17N3O5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-(4-nitrophenyl)sulfanylquinazolin-4-one |
| SMILES | COc1ccc(-n2c(Sc3ccc([N+](=O)[O-])cc3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C22H17N3O5S/c1-29-19-12-9-15(13-20(19)30-2)24-21(26)17-5-3-4-6-18(17)23-22(24)31-16-10-7-14(8-11-16)25(27)28/h3-13H,1-2H3 |
| InChIKey | VZWBKALHJXBGAC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|