C15H11Cl2N3O3S2 — CID 2805215
N'-(3,4-dichlorophenyl)sulfonyl-3-pyrrol-1-ylthiophene-2-carbohydrazide (PubChem CID 2805215) has the molecular formula C15H11Cl2N3O3S2 and a molecular weight of 416.31 g/mol. Its IUPAC name is N'-(3,4-dichlorophenyl)sulfonyl-3-pyrrol-1-ylthiophene-2-carbohydrazide.
| Compound Name | N'-(3,4-dichlorophenyl)sulfonyl-3-pyrrol-1-ylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 2805215 |
| Molecular Formula | C15H11Cl2N3O3S2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | N'-(3,4-dichlorophenyl)sulfonyl-3-pyrrol-1-ylthiophene-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(Cl)c(Cl)c1)c1sccc1-n1cccc1 |
| InChI | InChI=1S/C15H11Cl2N3O3S2/c16-11-4-3-10(9-12(11)17)25(22,23)19-18-15(21)14-13(5-8-24-14)20-6-1-2-7-20/h1-9,19H,(H,18,21) |
| InChIKey | ZDBVBHPMFKHCOI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|