C12H14ClNOS2 — CID 2805620
4-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide (PubChem CID 2805620) has the molecular formula C12H14ClNOS2 and a molecular weight of 287.84 g/mol. Its IUPAC name is 4-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide.
| Compound Name | 4-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide |
|---|---|
| PubChem CID | 2805620 |
| Molecular Formula | C12H14ClNOS2 |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-chloro-N-(2-methyl-1,3-dithian-5-yl)benzamide |
| SMILES | CC1SCC(NC(=O)c2ccc(Cl)cc2)CS1 |
| InChI | InChI=1S/C12H14ClNOS2/c1-8-16-6-11(7-17-8)14-12(15)9-2-4-10(13)5-3-9/h2-5,8,11H,6-7H2,1H3,(H,14,15) |
| InChIKey | IXUYDCUEVSCTTL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |