C22H34N2O2 — CID 2805781
N-butyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide (PubChem CID 2805781) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-butyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide.
| Compound Name | N-butyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 2805781 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N-butyl-4-(2,3,4,5,6-pentamethylbenzoyl)piperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCC(C(=O)c2c(C)c(C)c(C)c(C)c2C)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-7-8-11-23-22(26)24-12-9-19(10-13-24)21(25)20-17(5)15(3)14(2)16(4)18(20)6/h19H,7-13H2,1-6H3,(H,23,26) |
| InChIKey | ZJIPEBDHKBFTAV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|