C20H18BrN3O2S — CID 2806398
4-amino-5-(4-bromobenzoyl)-2-(2,4-dimethylanilino)thiophene-3-carboxamide (PubChem CID 2806398) has the molecular formula C20H18BrN3O2S and a molecular weight of 444.35 g/mol. Its IUPAC name is 4-amino-5-(4-bromobenzoyl)-2-(2,4-dimethylanilino)thiophene-3-carboxamide.
| Compound Name | 4-amino-5-(4-bromobenzoyl)-2-(2,4-dimethylanilino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2806398 |
| Molecular Formula | C20H18BrN3O2S |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 4-amino-5-(4-bromobenzoyl)-2-(2,4-dimethylanilino)thiophene-3-carboxamide |
| SMILES | Cc1ccc(Nc2sc(C(=O)c3ccc(Br)cc3)c(N)c2C(N)=O)c(C)c1 |
| InChI | InChI=1S/C20H18BrN3O2S/c1-10-3-8-14(11(2)9-10)24-20-15(19(23)26)16(22)18(27-20)17(25)12-4-6-13(21)7-5-12/h3-9,24H,22H2,1-2H3,(H2,23,26) |
| InChIKey | APCVSFLPHGKDIF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |