C26H22FN3O2S — CID 5059441
4-amino-5-(4-fluorobenzoyl)-2-(2-methylanilino)-N-(4-methylphenyl)thiophene-3-carboxamide (PubChem CID 5059441) has the molecular formula C26H22FN3O2S and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-amino-5-(4-fluorobenzoyl)-2-(2-methylanilino)-N-(4-methylphenyl)thiophene-3-carboxamide.
| Compound Name | 4-amino-5-(4-fluorobenzoyl)-2-(2-methylanilino)-N-(4-methylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 5059441 |
| Molecular Formula | C26H22FN3O2S |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-amino-5-(4-fluorobenzoyl)-2-(2-methylanilino)-N-(4-methylphenyl)thiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(Nc3ccccc3C)sc(C(=O)c3ccc(F)cc3)c2N)cc1 |
| InChI | InChI=1S/C26H22FN3O2S/c1-15-7-13-19(14-8-15)29-25(32)21-22(28)24(23(31)17-9-11-18(27)12-10-17)33-26(21)30-20-6-4-3-5-16(20)2/h3-14,30H,28H2,1-2H3,(H,29,32) |
| InChIKey | BPKAKOZRBONWNR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |