C27H24N4O5S — CID 5059445
4-amino-N-(4-ethoxyphenyl)-2-(2-methylanilino)-5-(3-nitrobenzoyl)thiophene-3-carboxamide (PubChem CID 5059445) has the molecular formula C27H24N4O5S and a molecular weight of 516.58 g/mol. Its IUPAC name is 4-amino-N-(4-ethoxyphenyl)-2-(2-methylanilino)-5-(3-nitrobenzoyl)thiophene-3-carboxamide.
| Compound Name | 4-amino-N-(4-ethoxyphenyl)-2-(2-methylanilino)-5-(3-nitrobenzoyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 5059445 |
| Molecular Formula | C27H24N4O5S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 4-amino-N-(4-ethoxyphenyl)-2-(2-methylanilino)-5-(3-nitrobenzoyl)thiophene-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2c(Nc3ccccc3C)sc(C(=O)c3cccc([N+](=O)[O-])c3)c2N)cc1 |
| InChI | InChI=1S/C27H24N4O5S/c1-3-36-20-13-11-18(12-14-20)29-26(33)22-23(28)25(24(32)17-8-6-9-19(15-17)31(34)35)37-27(22)30-21-10-5-4-7-16(21)2/h4-15,30H,3,28H2,1-2H3,(H,29,33) |
| InChIKey | SMAHMJFRVSGVIP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|