C27H20N4O5S — CID 23769743
3-amino-4-(furan-2-yl)-6-methyl-N-(2-methylphenyl)-2-(3-nitrobenzoyl)thieno[2,3-b]pyridine-5-carboxamide (PubChem CID 23769743) has the molecular formula C27H20N4O5S and a molecular weight of 512.55 g/mol. Its IUPAC name is 3-amino-4-(furan-2-yl)-6-methyl-N-(2-methylphenyl)-2-(3-nitrobenzoyl)thieno[2,3-b]pyridine-5-carboxamide.
| Compound Name | 3-amino-4-(furan-2-yl)-6-methyl-N-(2-methylphenyl)-2-(3-nitrobenzoyl)thieno[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 23769743 |
| Molecular Formula | C27H20N4O5S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 3-amino-4-(furan-2-yl)-6-methyl-N-(2-methylphenyl)-2-(3-nitrobenzoyl)thieno[2,3-b]pyridine-5-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1c(C)nc2sc(C(=O)c3cccc([N+](=O)[O-])c3)c(N)c2c1-c1ccco1 |
| InChI | InChI=1S/C27H20N4O5S/c1-14-7-3-4-10-18(14)30-26(33)20-15(2)29-27-22(21(20)19-11-6-12-36-19)23(28)25(37-27)24(32)16-8-5-9-17(13-16)31(34)35/h3-13H,28H2,1-2H3,(H,30,33) |
| InChIKey | IKQIRJBGUAOMMD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|