C26H24N4O5S — CID 46506347
ethyl 3-amino-5-[(2,4-dimethylphenyl)carbamoyl]-6-methyl-4-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 46506347) has the molecular formula C26H24N4O5S and a molecular weight of 504.57 g/mol. Its IUPAC name is ethyl 3-amino-5-[(2,4-dimethylphenyl)carbamoyl]-6-methyl-4-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | ethyl 3-amino-5-[(2,4-dimethylphenyl)carbamoyl]-6-methyl-4-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 46506347 |
| Molecular Formula | C26H24N4O5S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | ethyl 3-amino-5-[(2,4-dimethylphenyl)carbamoyl]-6-methyl-4-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(C)c(C(=O)Nc3ccc(C)cc3C)c(-c3cccc([N+](=O)[O-])c3)c2c1N |
| InChI | InChI=1S/C26H24N4O5S/c1-5-35-26(32)23-22(27)21-20(16-7-6-8-17(12-16)30(33)34)19(15(4)28-25(21)36-23)24(31)29-18-10-9-13(2)11-14(18)3/h6-12H,5,27H2,1-4H3,(H,29,31) |
| InChIKey | XNCJCKHFTWIOFB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|