C26H24N4O2S — CID 170995344
4-amino-2-anilino-5-benzoyl-N-[4-(dimethylamino)phenyl]thiophene-3-carboxamide (PubChem CID 170995344) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is 4-amino-2-anilino-5-benzoyl-N-[4-(dimethylamino)phenyl]thiophene-3-carboxamide.
| Compound Name | 4-amino-2-anilino-5-benzoyl-N-[4-(dimethylamino)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 170995344 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4-amino-2-anilino-5-benzoyl-N-[4-(dimethylamino)phenyl]thiophene-3-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2c(Nc3ccccc3)sc(C(=O)c3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C26H24N4O2S/c1-30(2)20-15-13-19(14-16-20)28-25(32)21-22(27)24(23(31)17-9-5-3-6-10-17)33-26(21)29-18-11-7-4-8-12-18/h3-16,29H,27H2,1-2H3,(H,28,32) |
| InChIKey | PLRNRZZTQPIPDK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|