C14H15Cl2NO2S — CID 2807128
2,5-dichloro-N-(1-ethynylcyclohexyl)benzenesulfonamide (PubChem CID 2807128) has the molecular formula C14H15Cl2NO2S and a molecular weight of 332.25 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-ethynylcyclohexyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(1-ethynylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2807128 |
| Molecular Formula | C14H15Cl2NO2S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2,5-dichloro-N-(1-ethynylcyclohexyl)benzenesulfonamide |
| SMILES | C#CC1(NS(=O)(=O)c2cc(Cl)ccc2Cl)CCCCC1 |
| InChI | InChI=1S/C14H15Cl2NO2S/c1-2-14(8-4-3-5-9-14)17-20(18,19)13-10-11(15)6-7-12(13)16/h1,6-7,10,17H,3-5,8-9H2 |
| InChIKey | QZWHIFOJRNZWCC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|