C13H15Cl2NO2S — CID 19684142
2,5-dichloro-N-(3-ethylpent-1-yn-3-yl)benzenesulfonamide (PubChem CID 19684142) has the molecular formula C13H15Cl2NO2S and a molecular weight of 320.24 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-ethylpent-1-yn-3-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(3-ethylpent-1-yn-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 19684142 |
| Molecular Formula | C13H15Cl2NO2S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2,5-dichloro-N-(3-ethylpent-1-yn-3-yl)benzenesulfonamide |
| SMILES | C#CC(CC)(CC)NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO2S/c1-4-13(5-2,6-3)16-19(17,18)12-9-10(14)7-8-11(12)15/h1,7-9,16H,5-6H2,2-3H3 |
| InChIKey | HWDXBNYSEZYFEI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|