C21H19N3O4 — CID 2807289
2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-pyridinyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2807289) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-pyridinyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-pyridinyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2807289 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-2-pyridinyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1c1cccc(N2C(=O)C3CC=CCC3C2=O)n1 |
| InChI | InChI=1S/C21H19N3O4/c25-18-12-6-1-2-7-13(12)19(26)23(18)16-10-5-11-17(22-16)24-20(27)14-8-3-4-9-15(14)21(24)28/h1-5,10-15H,6-9H2 |
| InChIKey | LKYSFJAHZIMQCE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|