C10H10N2O2 — CID 692333
1-(6-methyl-2-pyridinyl)pyrrolidine-2,5-dione (PubChem CID 692333) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(6-methyl-2-pyridinyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(6-methyl-2-pyridinyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 692333 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(6-methyl-2-pyridinyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)CCC2=O)n1 |
| InChI | InChI=1S/C10H10N2O2/c1-7-3-2-4-8(11-7)12-9(13)5-6-10(12)14/h2-4H,5-6H2,1H3 |
| InChIKey | VZPGOAHLWDOURV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|