C20H10N4S — CID 2807488
2-(3-cyano-4-thiophen-2-yl-1,5-dihydroindeno[1,2-b]pyridin-2-ylidene)propanedinitrile (PubChem CID 2807488) has the molecular formula C20H10N4S and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-(3-cyano-4-thiophen-2-yl-1,5-dihydroindeno[1,2-b]pyridin-2-ylidene)propanedinitrile.
| Compound Name | 2-(3-cyano-4-thiophen-2-yl-1,5-dihydroindeno[1,2-b]pyridin-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 2807488 |
| Molecular Formula | C20H10N4S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-(3-cyano-4-thiophen-2-yl-1,5-dihydroindeno[1,2-b]pyridin-2-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1NC2=C(Cc3ccccc32)C(c2cccs2)=C1C#N |
| InChI | InChI=1S/C20H10N4S/c21-9-13(10-22)19-16(11-23)18(17-6-3-7-25-17)15-8-12-4-1-2-5-14(12)20(15)24-19/h1-7,24H,8H2 |
| InChIKey | BJMSZRYOVWTIDU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|