C10H10N6O2 — CID 2809002
1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pyrrolidine-2,5-dione (PubChem CID 2809002) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2809002 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pyrrolidine-2,5-dione |
| SMILES | Cn1ncc2c(NN3C(=O)CCC3=O)ncnc21 |
| InChI | InChI=1S/C10H10N6O2/c1-15-10-6(4-13-15)9(11-5-12-10)14-16-7(17)2-3-8(16)18/h4-5H,2-3H2,1H3,(H,11,12,14) |
| InChIKey | KKKJGGMQMBTBMO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|