C15H20N6OS — CID 2810020
2-(1-ethyltetrazol-5-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 2810020) has the molecular formula C15H20N6OS and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-(1-ethyltetrazol-5-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 2810020 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | CCn1nnnc1SCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20N6OS/c1-2-21-15(16-17-18-21)23-12-14(22)20-10-8-19(9-11-20)13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3 |
| InChIKey | KHFQUEQATRFZFS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |