C17H22N6O2S — CID 645548
N-[3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide (PubChem CID 645548) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide.
| Compound Name | N-[3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 645548 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[3-[[2-(1-cyclopentyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CSc2nnnn2C2CCCC2)c1 |
| InChI | InChI=1S/C17H22N6O2S/c1-2-15(24)18-12-6-5-7-13(10-12)19-16(25)11-26-17-20-21-22-23(17)14-8-3-4-9-14/h5-7,10,14H,2-4,8-9,11H2,1H3,(H,18,24)(H,19,25) |
| InChIKey | APIPQMUDDPTEDC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |