C22H27F3N4O — CID 2810101
4-benzyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]morpholine (PubChem CID 2810101) has the molecular formula C22H27F3N4O and a molecular weight of 420.48 g/mol. Its IUPAC name is 4-benzyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]morpholine.
| Compound Name | 4-benzyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]morpholine |
|---|---|
| PubChem CID | 2810101 |
| Molecular Formula | C22H27F3N4O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-benzyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]morpholine |
| SMILES | FC(F)(F)c1ccc(N2CCN(CC3CN(Cc4ccccc4)CCO3)CC2)nc1 |
| InChI | InChI=1S/C22H27F3N4O/c23-22(24,25)19-6-7-21(26-14-19)29-10-8-27(9-11-29)16-20-17-28(12-13-30-20)15-18-4-2-1-3-5-18/h1-7,14,20H,8-13,15-17H2 |
| InChIKey | NXPVHLBNNYVZNP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |