About 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide
2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide (PubChem CID 28105) has the molecular formula C15H16IN
and a molecular weight of 337.20 g/mol. Its IUPAC name is 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide.
Molecular Properties
| Compound Name | 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide |
| PubChem CID | 28105 |
| Molecular Formula | C15H16IN |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide |
| SMILES | C[N+]1(c2ccccc2)Cc2ccccc2C1.[I-] |
| InChI | InChI=1S/C15H16N.HI/c1-16(15-9-3-2-4-10-15)11-13-7-5-6-8-14(13)12-16;/h2-10H,11-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | UAQIEBKYFPGMNS-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide?
The IUPAC name of 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide (CID 28105) is 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide.
What is the SMILES notation for 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide?
The canonical SMILES for 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide is C[N+]1(c2ccccc2)Cc2ccccc2C1.[I-].
What is the InChIKey of 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide?
The InChIKey is UAQIEBKYFPGMNS-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H16N.HI/c1-16(15-9-3-2-4-10-15)11-13-7-5-6-8-14(13)12-16;/h2-10H,11-12H2,1H3;1H/q+1;/p-1.
What are the key properties of 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide?
2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide has a molecular weight of 337.20 g/mol, XLogP of 0.34, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-phenyl-1,3-dihydroisoindol-2-ium iodide is sourced from PubChem (CID 28105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).