About N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide
N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 2810678) has the molecular formula C9H15N3O4S2
and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide |
| PubChem CID | 2810678 |
| Molecular Formula | C9H15N3O4S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)NC2CCS(=O)(=O)C2)cn1C |
| InChI | InChI=1S/C9H15N3O4S2/c1-7-10-9(5-12(7)2)18(15,16)11-8-3-4-17(13,14)6-8/h5,8,11H,3-4,6H2,1-2H3 |
| InChIKey | GLKNVOBMBAXNLP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide (CID 2810678) is N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide is Cc1nc(S(=O)(=O)NC2CCS(=O)(=O)C2)cn1C.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide?
The InChIKey is GLKNVOBMBAXNLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O4S2/c1-7-10-9(5-12(7)2)18(15,16)11-8-3-4-17(13,14)6-8/h5,8,11H,3-4,6H2,1-2H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide?
N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide has a molecular weight of 293.37 g/mol, XLogP of -0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide is sourced from PubChem (CID 2810678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).