C9H15N3O4S2 — CID 2810678
N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 2810678) has the molecular formula C9H15N3O4S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 2810678 |
| Molecular Formula | C9H15N3O4S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)NC2CCS(=O)(=O)C2)cn1C |
| InChI | InChI=1S/C9H15N3O4S2/c1-7-10-9(5-12(7)2)18(15,16)11-8-3-4-17(13,14)6-8/h5,8,11H,3-4,6H2,1-2H3 |
| InChIKey | GLKNVOBMBAXNLP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |