C20H29N3O2 — CID 2811236
N-(3,5-ditert-butyl-1-methylpyrazol-4-yl)-4-methoxybenzamide (PubChem CID 2811236) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-1-methylpyrazol-4-yl)-4-methoxybenzamide.
| Compound Name | N-(3,5-ditert-butyl-1-methylpyrazol-4-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 2811236 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-(3,5-ditert-butyl-1-methylpyrazol-4-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(C(C)(C)C)nn(C)c2C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29N3O2/c1-19(2,3)16-15(17(20(4,5)6)23(7)22-16)21-18(24)13-9-11-14(25-8)12-10-13/h9-12H,1-8H3,(H,21,24) |
| InChIKey | VOCYRDJHYJCIDF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |