C19H19N3OS2 — CID 2811874
N-(4-propan-2-ylphenyl)-2-(4-thiophen-2-ylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 2811874) has the molecular formula C19H19N3OS2 and a molecular weight of 369.52 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-2-(4-thiophen-2-ylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-propan-2-ylphenyl)-2-(4-thiophen-2-ylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2811874 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-2-(4-thiophen-2-ylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | CC(C)c1ccc(NC(=O)CSc2nccc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C19H19N3OS2/c1-13(2)14-5-7-15(8-6-14)21-18(23)12-25-19-20-10-9-16(22-19)17-4-3-11-24-17/h3-11,13H,12H2,1-2H3,(H,21,23) |
| InChIKey | UUBHDKPSKIQBFE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |