C16H12F3N3O2 — CID 2812003
N-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]furan-2-carboxamide (PubChem CID 2812003) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is N-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2812003 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[1-methyl-4-phenyl-3-(trifluoromethyl)pyrazol-5-yl]furan-2-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(-c2ccccc2)c1NC(=O)c1ccco1 |
| InChI | InChI=1S/C16H12F3N3O2/c1-22-14(20-15(23)11-8-5-9-24-11)12(10-6-3-2-4-7-10)13(21-22)16(17,18)19/h2-9H,1H3,(H,20,23) |
| InChIKey | JOCIQUSZYSARMD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |