C13H15FN2O2 — CID 2812855
3-(4-fluorophenyl)-1-propan-2-yl-1,3-diazinane-2,4-dione (PubChem CID 2812855) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-propan-2-yl-1,3-diazinane-2,4-dione.
| Compound Name | 3-(4-fluorophenyl)-1-propan-2-yl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 2812855 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-(4-fluorophenyl)-1-propan-2-yl-1,3-diazinane-2,4-dione |
| SMILES | CC(C)N1CCC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C13H15FN2O2/c1-9(2)15-8-7-12(17)16(13(15)18)11-5-3-10(14)4-6-11/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | JRQTVGCQFOLPJK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |