About ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate
ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate (PubChem CID 2813269) has the molecular formula C19H24N2O3
and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 2813269 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc3c(C)cc(C)cc3[nH]2)CC1 |
| InChI | InChI=1S/C19H24N2O3/c1-4-24-19(23)14-5-7-21(8-6-14)18(22)17-11-15-13(3)9-12(2)10-16(15)20-17/h9-11,14,20H,4-8H2,1-3H3 |
| InChIKey | ZXSVYMSVMLCEFL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate (CID 2813269) is ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)c2cc3c(C)cc(C)cc3[nH]2)CC1.
What is the InChIKey of ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate?
The InChIKey is ZXSVYMSVMLCEFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O3/c1-4-24-19(23)14-5-7-21(8-6-14)18(22)17-11-15-13(3)9-12(2)10-16(15)20-17/h9-11,14,20H,4-8H2,1-3H3.
What are the key properties of ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate?
ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate has a molecular weight of 328.41 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(4,6-dimethyl-1H-indole-2-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 2813269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).