C18H18N4O2 — CID 2813279
5-butyl-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 2813279) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 5-butyl-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 5-butyl-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 2813279 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-butyl-11-phenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | CCCCN1Cc2c(nc3cc(-c4ccccc4)[nH]n3c2=O)C1=O |
| InChI | InChI=1S/C18H18N4O2/c1-2-3-9-21-11-13-16(18(21)24)19-15-10-14(20-22(15)17(13)23)12-7-5-4-6-8-12/h4-8,10,20H,2-3,9,11H2,1H3 |
| InChIKey | LYDHPCCGXZZPIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |