C18H17ClN6O2S — CID 2813702
1-(4-chlorophenyl)-3-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]urea (PubChem CID 2813702) has the molecular formula C18H17ClN6O2S and a molecular weight of 416.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]urea |
|---|---|
| PubChem CID | 2813702 |
| Molecular Formula | C18H17ClN6O2S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]urea |
| SMILES | Cn1c(SCC(=O)NNC(=O)Nc2ccc(Cl)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H17ClN6O2S/c1-25-16(12-5-3-2-4-6-12)22-24-18(25)28-11-15(26)21-23-17(27)20-14-9-7-13(19)8-10-14/h2-10H,11H2,1H3,(H,21,26)(H2,20,23,27) |
| InChIKey | NYWJBDPIJAUVAY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|