C13H12ClF3N6O2S — CID 110189495
1-(4-chlorophenyl)-3-[[2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]urea (PubChem CID 110189495) has the molecular formula C13H12ClF3N6O2S and a molecular weight of 408.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[[2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]urea |
|---|---|
| PubChem CID | 110189495 |
| Molecular Formula | C13H12ClF3N6O2S |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]urea |
| SMILES | Cn1c(SCC(=O)NNC(=O)Nc2ccc(Cl)cc2)nnc1C(F)(F)F |
| InChI | InChI=1S/C13H12ClF3N6O2S/c1-23-10(13(15,16)17)20-22-12(23)26-6-9(24)19-21-11(25)18-8-4-2-7(14)3-5-8/h2-5H,6H2,1H3,(H,19,24)(H2,18,21,25) |
| InChIKey | FOEOSOAVHKXJOV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|