C20H13F3N4O3S — CID 4306158
N-(9,10-dioxoanthracen-2-yl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4306158) has the molecular formula C20H13F3N4O3S and a molecular weight of 446.41 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4306158 |
| Molecular Formula | C20H13F3N4O3S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)nnc1C(F)(F)F |
| InChI | InChI=1S/C20H13F3N4O3S/c1-27-18(20(21,22)23)25-26-19(27)31-9-15(28)24-10-6-7-13-14(8-10)17(30)12-5-3-2-4-11(12)16(13)29/h2-8H,9H2,1H3,(H,24,28) |
| InChIKey | GXQHBJXSMVLDCZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|