C12H20N2O3S — CID 2814174
N-cyclohexyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 2814174) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-cyclohexyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-cyclohexyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 2814174 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-cyclohexyl-N,3,5-trimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2O3S/c1-9-12(10(2)17-13-9)18(15,16)14(3)11-7-5-4-6-8-11/h11H,4-8H2,1-3H3 |
| InChIKey | CSHIUWGZDLBJQB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |