C13H24N2O3S — CID 58624073
N,N-ditert-butyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 58624073) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is N,N-ditert-butyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N,N-ditert-butyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 58624073 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N,N-ditert-butyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H24N2O3S/c1-9-11(10(2)18-14-9)19(16,17)15(12(3,4)5)13(6,7)8/h1-8H3 |
| InChIKey | AHHFIBDNPVLJTF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |