C20H13F3N2O4 — CID 2814191
2-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]benzoic acid (PubChem CID 2814191) has the molecular formula C20H13F3N2O4 and a molecular weight of 402.33 g/mol. Its IUPAC name is 2-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 2814191 |
| Molecular Formula | C20H13F3N2O4 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccc(Oc2cccc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C20H13F3N2O4/c21-20(22,23)12-4-3-5-14(10-12)29-17-9-8-13(11-24-17)25-18(26)15-6-1-2-7-16(15)19(27)28/h1-11H,(H,25,26)(H,27,28) |
| InChIKey | APBSWLNZEMLWTF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |