C20H20N4O2S2 — CID 2815045
N-[(4-methoxyphenyl)methylideneamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)acetamide (PubChem CID 2815045) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methylideneamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)acetamide.
| Compound Name | N-[(4-methoxyphenyl)methylideneamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2815045 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[(4-methoxyphenyl)methylideneamino]-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)acetamide |
| SMILES | COc1ccc(C=NNC(=O)CSc2ncnc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C20H20N4O2S2/c1-26-14-8-6-13(7-9-14)10-23-24-17(25)11-27-19-18-15-4-2-3-5-16(15)28-20(18)22-12-21-19/h6-10,12H,2-5,11H2,1H3,(H,24,25) |
| InChIKey | JXQCUDYCLRBITJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|