C19H19N3O2S — CID 2815112
8,8-dimethyl-5-phenyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 2815112) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 8,8-dimethyl-5-phenyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 8,8-dimethyl-5-phenyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 2815112 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 8,8-dimethyl-5-phenyl-2-sulfanylidene-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1[nH]c(=S)[nH]c(=O)c1C2c1ccccc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-19(2)8-11-14(12(23)9-19)13(10-6-4-3-5-7-10)15-16(20-11)21-18(25)22-17(15)24/h3-7,13H,8-9H2,1-2H3,(H3,20,21,22,24,25) |
| InChIKey | ONGNCADZJOQNFG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|