C12H12N2OS — CID 697326
5-benzyl-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 697326) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 5-benzyl-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-benzyl-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 697326 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5-benzyl-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | Cc1[nH]c(=S)[nH]c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C12H12N2OS/c1-8-10(11(15)14-12(16)13-8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H2,13,14,15,16) |
| InChIKey | DNEXCHUDIUXJAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|