C23H18N4O2S2 — CID 2815355
2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenothiazin-10-ylethanone (PubChem CID 2815355) has the molecular formula C23H18N4O2S2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenothiazin-10-ylethanone.
| Compound Name | 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenothiazin-10-ylethanone |
|---|---|
| PubChem CID | 2815355 |
| Molecular Formula | C23H18N4O2S2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenothiazin-10-ylethanone |
| SMILES | C=CCn1c(SCC(=O)N2c3ccccc3Sc3ccccc32)nnc1-c1ccco1 |
| InChI | InChI=1S/C23H18N4O2S2/c1-2-13-26-22(18-10-7-14-29-18)24-25-23(26)30-15-21(28)27-16-8-3-5-11-19(16)31-20-12-6-4-9-17(20)27/h2-12,14H,1,13,15H2 |
| InChIKey | FXDZKNUOWHTUJT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|