C19H18Cl2N4O2S — CID 46670757
N-[1-(3,4-dichlorophenyl)ethyl]-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 46670757) has the molecular formula C19H18Cl2N4O2S and a molecular weight of 437.35 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 46670757 |
| Molecular Formula | C19H18Cl2N4O2S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC(C)c2ccc(Cl)c(Cl)c2)nnc1-c1ccco1 |
| InChI | InChI=1S/C19H18Cl2N4O2S/c1-3-8-25-18(16-5-4-9-27-16)23-24-19(25)28-11-17(26)22-12(2)13-6-7-14(20)15(21)10-13/h3-7,9-10,12H,1,8,11H2,2H3,(H,22,26) |
| InChIKey | ZPEBXAZSLNETGF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|