C20H21BrN4O2S — CID 3920319
N-(4-bromo-2-propan-2-ylphenyl)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3920319) has the molecular formula C20H21BrN4O2S and a molecular weight of 461.39 g/mol. Its IUPAC name is N-(4-bromo-2-propan-2-ylphenyl)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-bromo-2-propan-2-ylphenyl)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3920319 |
| Molecular Formula | C20H21BrN4O2S |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | N-(4-bromo-2-propan-2-ylphenyl)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Br)cc2C(C)C)nnc1-c1ccco1 |
| InChI | InChI=1S/C20H21BrN4O2S/c1-4-9-25-19(17-6-5-10-27-17)23-24-20(25)28-12-18(26)22-16-8-7-14(21)11-15(16)13(2)3/h4-8,10-11,13H,1,9,12H2,2-3H3,(H,22,26) |
| InChIKey | FFMRVHWIHXYITL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|