C18H13N3O — CID 2815521
5-naphthalen-1-yl-N-phenyl-1,3,4-oxadiazol-2-amine (PubChem CID 2815521) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-naphthalen-1-yl-N-phenyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-naphthalen-1-yl-N-phenyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 2815521 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-naphthalen-1-yl-N-phenyl-1,3,4-oxadiazol-2-amine |
| SMILES | c1ccc(Nc2nnc(-c3cccc4ccccc34)o2)cc1 |
| InChI | InChI=1S/C18H13N3O/c1-2-9-14(10-3-1)19-18-21-20-17(22-18)16-12-6-8-13-7-4-5-11-15(13)16/h1-12H,(H,19,21) |
| InChIKey | IECBEQWOBYQZIS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |